C27H21N5O3S — CID 41115721
[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-phenylquinolin-4-yl)methanone (PubChem CID 41115721) has the molecular formula C27H21N5O3S and a molecular weight of 495.56 g/mol. Its IUPAC name is [4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-phenylquinolin-4-yl)methanone.
| Compound Name | [4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-phenylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 41115721 |
| Molecular Formula | C27H21N5O3S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | [4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-phenylquinolin-4-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)nc2ccccc12)N1CCN(c2nc3ccc([N+](=O)[O-])cc3s2)CC1 |
| InChI | InChI=1S/C27H21N5O3S/c33-26(21-17-24(18-6-2-1-3-7-18)28-22-9-5-4-8-20(21)22)30-12-14-31(15-13-30)27-29-23-11-10-19(32(34)35)16-25(23)36-27/h1-11,16-17H,12-15H2 |
| InChIKey | VKSNGRAKSRZSDB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|