C12H13N3O2S — CID 142902771
5-nitro-2-piperidin-4-yl-1,3-benzothiazole (PubChem CID 142902771) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 5-nitro-2-piperidin-4-yl-1,3-benzothiazole.
| Compound Name | 5-nitro-2-piperidin-4-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 142902771 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 5-nitro-2-piperidin-4-yl-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2sc(C3CCNCC3)nc2c1 |
| InChI | InChI=1S/C12H13N3O2S/c16-15(17)9-1-2-11-10(7-9)14-12(18-11)8-3-5-13-6-4-8/h1-2,7-8,13H,3-6H2 |
| InChIKey | AHAZVEWSFCWJGK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|