C11H12ClN3O3S2 — CID 170987769
5-nitro-2-[(S)-[(3R)-pyrrolidin-3-yl]sulfinyl]-1,3-benzothiazole;hydrochloride (PubChem CID 170987769) has the molecular formula C11H12ClN3O3S2 and a molecular weight of 333.82 g/mol. Its IUPAC name is 5-nitro-2-[(S)-[(3R)-pyrrolidin-3-yl]sulfinyl]-1,3-benzothiazole;hydrochloride.
| Compound Name | 5-nitro-2-[(S)-[(3R)-pyrrolidin-3-yl]sulfinyl]-1,3-benzothiazole;hydrochloride |
|---|---|
| PubChem CID | 170987769 |
| Molecular Formula | C11H12ClN3O3S2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 5-nitro-2-[(S)-[(3R)-pyrrolidin-3-yl]sulfinyl]-1,3-benzothiazole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2sc([S@@](=O)[C@@H]3CCNC3)nc2c1 |
| InChI | InChI=1S/C11H11N3O3S2.ClH/c15-14(16)7-1-2-10-9(5-7)13-11(18-10)19(17)8-3-4-12-6-8;/h1-2,5,8,12H,3-4,6H2;1H/t8-,19+;/m1./s1 |
| InChIKey | SPCYEAUKVVLCCC-OZXQFPOCSA-N |
| XLogP | 2.10 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|