C11H12N2OS2 — CID 97165838
2-[(R)-[(3R)-pyrrolidin-3-yl]sulfinyl]-1,3-benzothiazole (PubChem CID 97165838) has the molecular formula C11H12N2OS2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-[(R)-[(3R)-pyrrolidin-3-yl]sulfinyl]-1,3-benzothiazole.
| Compound Name | 2-[(R)-[(3R)-pyrrolidin-3-yl]sulfinyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 97165838 |
| Molecular Formula | C11H12N2OS2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 2-[(R)-[(3R)-pyrrolidin-3-yl]sulfinyl]-1,3-benzothiazole |
| SMILES | O=[S@@](c1nc2ccccc2s1)[C@@H]1CCNC1 |
| InChI | InChI=1S/C11H12N2OS2/c14-16(8-5-6-12-7-8)11-13-9-3-1-2-4-10(9)15-11/h1-4,8,12H,5-7H2/t8-,16-/m1/s1 |
| InChIKey | UCRLMZWBNCRKLD-VPTHRUTESA-N |
| XLogP | 1.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |