C12H14N2OS2 — CID 97166415
2-[(S)-[(3S)-pyrrolidin-3-yl]methylsulfinyl]-1,3-benzothiazole (PubChem CID 97166415) has the molecular formula C12H14N2OS2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-[(S)-[(3S)-pyrrolidin-3-yl]methylsulfinyl]-1,3-benzothiazole.
| Compound Name | 2-[(S)-[(3S)-pyrrolidin-3-yl]methylsulfinyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 97166415 |
| Molecular Formula | C12H14N2OS2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-[(S)-[(3S)-pyrrolidin-3-yl]methylsulfinyl]-1,3-benzothiazole |
| SMILES | O=[S@@](C[C@H]1CCNC1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H14N2OS2/c15-17(8-9-5-6-13-7-9)12-14-10-3-1-2-4-11(10)16-12/h1-4,9,13H,5-8H2/t9-,17-/m0/s1 |
| InChIKey | DVHQKWYZCJYFQT-XYZCENFISA-N |
| XLogP | 2.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |