C11H13ClN2OS2 — CID 71645444
2-[(3R)-pyrrolidin-3-yl]sulfinyl-1,3-benzothiazole;hydrochloride (PubChem CID 71645444) has the molecular formula C11H13ClN2OS2 and a molecular weight of 288.82 g/mol. Its IUPAC name is 2-[(3R)-pyrrolidin-3-yl]sulfinyl-1,3-benzothiazole;hydrochloride.
| Compound Name | 2-[(3R)-pyrrolidin-3-yl]sulfinyl-1,3-benzothiazole;hydrochloride |
|---|---|
| PubChem CID | 71645444 |
| Molecular Formula | C11H13ClN2OS2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 2-[(3R)-pyrrolidin-3-yl]sulfinyl-1,3-benzothiazole;hydrochloride |
| SMILES | Cl.O=S(c1nc2ccccc2s1)[C@@H]1CCNC1 |
| InChI | InChI=1S/C11H12N2OS2.ClH/c14-16(8-5-6-12-7-8)11-13-9-3-1-2-4-10(9)15-11;/h1-4,8,12H,5-7H2;1H/t8-,16?;/m1./s1 |
| InChIKey | WPEGJCLHAUIJBQ-DFPMHDRFSA-N |
| XLogP | 2.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |