C12H14N2OS — CID 62372647
2-(pyrrolidin-3-ylmethoxy)-1,3-benzothiazole (PubChem CID 62372647) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-(pyrrolidin-3-ylmethoxy)-1,3-benzothiazole.
| Compound Name | 2-(pyrrolidin-3-ylmethoxy)-1,3-benzothiazole |
|---|---|
| PubChem CID | 62372647 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-(pyrrolidin-3-ylmethoxy)-1,3-benzothiazole |
| SMILES | c1ccc2sc(OCC3CCNC3)nc2c1 |
| InChI | InChI=1S/C12H14N2OS/c1-2-4-11-10(3-1)14-12(16-11)15-8-9-5-6-13-7-9/h1-4,9,13H,5-8H2 |
| InChIKey | XEIKZOTUDNNWBW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |