C13H17ClN2OS — CID 71636954
2-(piperidin-2-ylmethoxy)-1,3-benzothiazole;hydrochloride (PubChem CID 71636954) has the molecular formula C13H17ClN2OS and a molecular weight of 284.81 g/mol. Its IUPAC name is 2-(piperidin-2-ylmethoxy)-1,3-benzothiazole;hydrochloride.
| Compound Name | 2-(piperidin-2-ylmethoxy)-1,3-benzothiazole;hydrochloride |
|---|---|
| PubChem CID | 71636954 |
| Molecular Formula | C13H17ClN2OS |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-(piperidin-2-ylmethoxy)-1,3-benzothiazole;hydrochloride |
| SMILES | Cl.c1ccc2sc(OCC3CCCCN3)nc2c1 |
| InChI | InChI=1S/C13H16N2OS.ClH/c1-2-7-12-11(6-1)15-13(17-12)16-9-10-5-3-4-8-14-10;/h1-2,6-7,10,14H,3-5,8-9H2;1H |
| InChIKey | LCDUNUJSWKOTJC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |