C15H18N2OS — CID 79537658
2-(azepan-2-yl)-1-(1,3-benzothiazol-2-yl)ethanone (PubChem CID 79537658) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-(azepan-2-yl)-1-(1,3-benzothiazol-2-yl)ethanone.
| Compound Name | 2-(azepan-2-yl)-1-(1,3-benzothiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 79537658 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-(azepan-2-yl)-1-(1,3-benzothiazol-2-yl)ethanone |
| SMILES | O=C(CC1CCCCCN1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H18N2OS/c18-13(10-11-6-2-1-5-9-16-11)15-17-12-7-3-4-8-14(12)19-15/h3-4,7-8,11,16H,1-2,5-6,9-10H2 |
| InChIKey | LOAXBSFAZNPGCC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |