C12H14N2OS — CID 97178424
3-[[(2R)-pyrrolidin-2-yl]methoxy]-1,2-benzothiazole (PubChem CID 97178424) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 3-[[(2R)-pyrrolidin-2-yl]methoxy]-1,2-benzothiazole.
| Compound Name | 3-[[(2R)-pyrrolidin-2-yl]methoxy]-1,2-benzothiazole |
|---|---|
| PubChem CID | 97178424 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 3-[[(2R)-pyrrolidin-2-yl]methoxy]-1,2-benzothiazole |
| SMILES | c1ccc2c(OC[C@H]3CCCN3)nsc2c1 |
| InChI | InChI=1S/C12H14N2OS/c1-2-6-11-10(5-1)12(14-16-11)15-8-9-4-3-7-13-9/h1-2,5-6,9,13H,3-4,7-8H2/t9-/m1/s1 |
| InChIKey | FJAZUVGGANTUSO-SECBINFHSA-N |
| XLogP | 2.43 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |