C14H19ClN2OS — CID 71636569
3-(2-piperidin-2-ylethoxy)-1,2-benzothiazole;hydrochloride (PubChem CID 71636569) has the molecular formula C14H19ClN2OS and a molecular weight of 298.84 g/mol. Its IUPAC name is 3-(2-piperidin-2-ylethoxy)-1,2-benzothiazole;hydrochloride.
| Compound Name | 3-(2-piperidin-2-ylethoxy)-1,2-benzothiazole;hydrochloride |
|---|---|
| PubChem CID | 71636569 |
| Molecular Formula | C14H19ClN2OS |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 3-(2-piperidin-2-ylethoxy)-1,2-benzothiazole;hydrochloride |
| SMILES | Cl.c1ccc2c(OCCC3CCCCN3)nsc2c1 |
| InChI | InChI=1S/C14H18N2OS.ClH/c1-2-7-13-12(6-1)14(16-18-13)17-10-8-11-5-3-4-9-15-11;/h1-2,6-7,11,15H,3-5,8-10H2;1H |
| InChIKey | QSWXAVQUVMPOML-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |