C11H13NOS — CID 591887
3-butoxy-1,2-benzothiazole (PubChem CID 591887) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is 3-butoxy-1,2-benzothiazole.
| Compound Name | 3-butoxy-1,2-benzothiazole |
|---|---|
| PubChem CID | 591887 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 3-butoxy-1,2-benzothiazole |
| SMILES | CCCCOc1nsc2ccccc12 |
| InChI | InChI=1S/C11H13NOS/c1-2-3-8-13-11-9-6-4-5-7-10(9)14-12-11/h4-7H,2-3,8H2,1H3 |
| InChIKey | AZHMYAOAMGOQQJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|