C14H18N4O — CID 103204979
3-(2-piperidin-2-ylethoxy)-1,2,4-benzotriazine (PubChem CID 103204979) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-(2-piperidin-2-ylethoxy)-1,2,4-benzotriazine.
| Compound Name | 3-(2-piperidin-2-ylethoxy)-1,2,4-benzotriazine |
|---|---|
| PubChem CID | 103204979 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-(2-piperidin-2-ylethoxy)-1,2,4-benzotriazine |
| SMILES | c1ccc2nc(OCCC3CCCCN3)nnc2c1 |
| InChI | InChI=1S/C14H18N4O/c1-2-7-13-12(6-1)16-14(18-17-13)19-10-8-11-5-3-4-9-15-11/h1-2,6-7,11,15H,3-5,8-10H2 |
| InChIKey | CAEZKEQFLJJJJL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |