C13H21N3O3 — CID 115355534
4,6-dimethoxy-2-(2-piperidin-2-ylethoxy)pyrimidine (PubChem CID 115355534) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4,6-dimethoxy-2-(2-piperidin-2-ylethoxy)pyrimidine.
| Compound Name | 4,6-dimethoxy-2-(2-piperidin-2-ylethoxy)pyrimidine |
|---|---|
| PubChem CID | 115355534 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4,6-dimethoxy-2-(2-piperidin-2-ylethoxy)pyrimidine |
| SMILES | COc1cc(OC)nc(OCCC2CCCCN2)n1 |
| InChI | InChI=1S/C13H21N3O3/c1-17-11-9-12(18-2)16-13(15-11)19-8-6-10-5-3-4-7-14-10/h9-10,14H,3-8H2,1-2H3 |
| InChIKey | CQUOCMGWKPCAJJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |