C17H21ClN2O — CID 69004873
5-benzyl-2-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine;hydrochloride (PubChem CID 69004873) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is 5-benzyl-2-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine;hydrochloride.
| Compound Name | 5-benzyl-2-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine;hydrochloride |
|---|---|
| PubChem CID | 69004873 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 5-benzyl-2-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine;hydrochloride |
| SMILES | Cl.c1ccc(Cc2ccc(OC[C@@H]3CCCN3)nc2)cc1 |
| InChI | InChI=1S/C17H20N2O.ClH/c1-2-5-14(6-3-1)11-15-8-9-17(19-12-15)20-13-16-7-4-10-18-16;/h1-3,5-6,8-9,12,16,18H,4,7,10-11,13H2;1H/t16-;/m0./s1 |
| InChIKey | DRLVHGGXXCHTRY-NTISSMGPSA-N |
| XLogP | 3.22 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |