C10H14N2O — CID 10535320
3-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine (PubChem CID 10535320) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 3-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine.
| Compound Name | 3-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 10535320 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine |
| SMILES | c1cncc(OC[C@@H]2CCCN2)c1 |
| InChI | InChI=1S/C10H14N2O/c1-3-9(12-6-1)8-13-10-4-2-5-11-7-10/h2,4-5,7,9,12H,1,3,6,8H2/t9-/m0/s1 |
| InChIKey | MKTQWLYJCQUWGP-VIFPVBQESA-N |
| XLogP | 1.21 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |