C10H16Cl2N2O — CID 138393569
3-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine;dihydrochloride (PubChem CID 138393569) has the molecular formula C10H16Cl2N2O and a molecular weight of 251.16 g/mol. Its IUPAC name is 3-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine;dihydrochloride.
| Compound Name | 3-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine;dihydrochloride |
|---|---|
| PubChem CID | 138393569 |
| Molecular Formula | C10H16Cl2N2O |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 3-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine;dihydrochloride |
| SMILES | Cl.Cl.c1cncc(OC[C@@H]2CCCN2)c1 |
| InChI | InChI=1S/C10H14N2O.2ClH/c1-3-9(12-6-1)8-13-10-4-2-5-11-7-10;;/h2,4-5,7,9,12H,1,3,6,8H2;2*1H/t9-;;/m0../s1 |
| InChIKey | SAMAYWZHGLVJMN-WWPIYYJJSA-N |
| XLogP | 2.06 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |