C9H14Cl2N2O — CID 18391704
3-[[(2R)-azetidin-2-yl]methoxy]pyridine;dihydrochloride (PubChem CID 18391704) has the molecular formula C9H14Cl2N2O and a molecular weight of 237.13 g/mol. Its IUPAC name is 3-[[(2R)-azetidin-2-yl]methoxy]pyridine;dihydrochloride.
| Compound Name | 3-[[(2R)-azetidin-2-yl]methoxy]pyridine;dihydrochloride |
|---|---|
| PubChem CID | 18391704 |
| Molecular Formula | C9H14Cl2N2O |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 3-[[(2R)-azetidin-2-yl]methoxy]pyridine;dihydrochloride |
| SMILES | Cl.Cl.c1cncc(OC[C@H]2CCN2)c1 |
| InChI | InChI=1S/C9H12N2O.2ClH/c1-2-9(6-10-4-1)12-7-8-3-5-11-8;;/h1-2,4,6,8,11H,3,5,7H2;2*1H/t8-;;/m1../s1 |
| InChIKey | GVEVDINKRFDXFP-YCBDHFTFSA-N |
| XLogP | 1.67 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |