C12H16N2O — CID 166917917
3-[[(2S)-5-methyl-1,2,3,6-tetrahydropyridin-2-yl]methoxy]pyridine (PubChem CID 166917917) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-[[(2S)-5-methyl-1,2,3,6-tetrahydropyridin-2-yl]methoxy]pyridine.
| Compound Name | 3-[[(2S)-5-methyl-1,2,3,6-tetrahydropyridin-2-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 166917917 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-[[(2S)-5-methyl-1,2,3,6-tetrahydropyridin-2-yl]methoxy]pyridine |
| SMILES | CC1=CC[C@@H](COc2cccnc2)NC1 |
| InChI | InChI=1S/C12H16N2O/c1-10-4-5-11(14-7-10)9-15-12-3-2-6-13-8-12/h2-4,6,8,11,14H,5,7,9H2,1H3/t11-/m0/s1 |
| InChIKey | OYSFQGCDXLBTQI-NSHDSACASA-N |
| XLogP | 1.77 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|