C11H15NO2 — CID 103141074
3-[(5-methyloxolan-2-yl)methoxy]pyridine (PubChem CID 103141074) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-[(5-methyloxolan-2-yl)methoxy]pyridine.
| Compound Name | 3-[(5-methyloxolan-2-yl)methoxy]pyridine |
|---|---|
| PubChem CID | 103141074 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3-[(5-methyloxolan-2-yl)methoxy]pyridine |
| SMILES | CC1CCC(COc2cccnc2)O1 |
| InChI | InChI=1S/C11H15NO2/c1-9-4-5-11(14-9)8-13-10-3-2-6-12-7-10/h2-3,6-7,9,11H,4-5,8H2,1H3 |
| InChIKey | KDECQYLRMCMVEU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |