C14H20O3 — CID 103135165
(1S)-1-[3-[(5-methyloxolan-2-yl)methoxy]phenyl]ethanol (PubChem CID 103135165) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1S)-1-[3-[(5-methyloxolan-2-yl)methoxy]phenyl]ethanol.
| Compound Name | (1S)-1-[3-[(5-methyloxolan-2-yl)methoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 103135165 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1S)-1-[3-[(5-methyloxolan-2-yl)methoxy]phenyl]ethanol |
| SMILES | CC1CCC(COc2cccc([C@H](C)O)c2)O1 |
| InChI | InChI=1S/C14H20O3/c1-10-6-7-14(17-10)9-16-13-5-3-4-12(8-13)11(2)15/h3-5,8,10-11,14-15H,6-7,9H2,1-2H3/t10?,11-,14?/m0/s1 |
| InChIKey | QMCMPYNITVGNTG-CVZZAPKMSA-N |
| XLogP | 2.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |