C14H18N2O5 — CID 67586557
(E)-but-2-enedioic acid;3-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine (PubChem CID 67586557) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine.
| Compound Name | (E)-but-2-enedioic acid;3-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 67586557 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (E)-but-2-enedioic acid;3-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine |
| SMILES | O=C(O)/C=C/C(=O)O.c1cncc(OC[C@@H]2CCCN2)c1 |
| InChI | InChI=1S/C10H14N2O.C4H4O4/c1-3-9(12-6-1)8-13-10-4-2-5-11-7-10;5-3(6)1-2-4(7)8/h2,4-5,7,9,12H,1,3,6,8H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t9-;/m0./s1 |
| InChIKey | LUWZJIGDNYPNJA-AFIAKLHKSA-N |
| XLogP | 0.92 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|