C15H20N2O5 — CID 66629517
(E)-but-2-enedioic acid;3-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyridine (PubChem CID 66629517) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyridine.
| Compound Name | (E)-but-2-enedioic acid;3-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 66629517 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (E)-but-2-enedioic acid;3-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyridine |
| SMILES | CN1CCC[C@H]1COc1cccnc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H16N2O.C4H4O4/c1-13-7-3-4-10(13)9-14-11-5-2-6-12-8-11;5-3(6)1-2-4(7)8/h2,5-6,8,10H,3-4,7,9H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t10-;/m0./s1 |
| InChIKey | HINROBBHECKORZ-PBBCPHEYSA-N |
| XLogP | 1.27 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|