C14H23N3O2 — CID 54177761
3-methoxypyridine;N-[(1-methylpyrrolidin-2-yl)methyl]acetamide (PubChem CID 54177761) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-methoxypyridine;N-[(1-methylpyrrolidin-2-yl)methyl]acetamide.
| Compound Name | 3-methoxypyridine;N-[(1-methylpyrrolidin-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 54177761 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 3-methoxypyridine;N-[(1-methylpyrrolidin-2-yl)methyl]acetamide |
| SMILES | CC(=O)NCC1CCCN1C.COc1cccnc1 |
| InChI | InChI=1S/C8H16N2O.C6H7NO/c1-7(11)9-6-8-4-3-5-10(8)2;1-8-6-3-2-4-7-5-6/h8H,3-6H2,1-2H3,(H,9,11);2-5H,1H3 |
| InChIKey | OZQCOVHVBFTRAQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |