C11H16N2O2 — CID 122208649
5-[(1-methylpyrrolidin-2-yl)methoxy]pyridin-3-ol (PubChem CID 122208649) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 5-[(1-methylpyrrolidin-2-yl)methoxy]pyridin-3-ol.
| Compound Name | 5-[(1-methylpyrrolidin-2-yl)methoxy]pyridin-3-ol |
|---|---|
| PubChem CID | 122208649 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 5-[(1-methylpyrrolidin-2-yl)methoxy]pyridin-3-ol |
| SMILES | CN1CCCC1COc1cncc(O)c1 |
| InChI | InChI=1S/C11H16N2O2/c1-13-4-2-3-9(13)8-15-11-5-10(14)6-12-7-11/h5-7,9,14H,2-4,8H2,1H3 |
| InChIKey | VRDFPEYWEQFXGS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |