C14H24Cl2N2O — CID 67585227
3-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5-propylpyridine;dihydrochloride (PubChem CID 67585227) has the molecular formula C14H24Cl2N2O and a molecular weight of 307.27 g/mol. Its IUPAC name is 3-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5-propylpyridine;dihydrochloride.
| Compound Name | 3-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5-propylpyridine;dihydrochloride |
|---|---|
| PubChem CID | 67585227 |
| Molecular Formula | C14H24Cl2N2O |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 3-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5-propylpyridine;dihydrochloride |
| SMILES | CCCc1cncc(OC[C@@H]2CCCN2C)c1.Cl.Cl |
| InChI | InChI=1S/C14H22N2O.2ClH/c1-3-5-12-8-14(10-15-9-12)17-11-13-6-4-7-16(13)2;;/h8-10,13H,3-7,11H2,1-2H3;2*1H/t13-;;/m0../s1 |
| InChIKey | AGMDRRHFOHUACL-GXKRWWSZSA-N |
| XLogP | 3.35 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |