C13H17NO2 — CID 117051893
3-[(1-methylpyrrolidin-2-yl)methoxy]benzaldehyde (PubChem CID 117051893) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-[(1-methylpyrrolidin-2-yl)methoxy]benzaldehyde.
| Compound Name | 3-[(1-methylpyrrolidin-2-yl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 117051893 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-[(1-methylpyrrolidin-2-yl)methoxy]benzaldehyde |
| SMILES | CN1CCCC1COc1cccc(C=O)c1 |
| InChI | InChI=1S/C13H17NO2/c1-14-7-3-5-12(14)10-16-13-6-2-4-11(8-13)9-15/h2,4,6,8-9,12H,3,5,7,10H2,1H3 |
| InChIKey | ASVXMNKGCNQCDB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|