C17H25NO2 — CID 99991988
3-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propoxy]benzaldehyde (PubChem CID 99991988) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 3-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propoxy]benzaldehyde.
| Compound Name | 3-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propoxy]benzaldehyde |
|---|---|
| PubChem CID | 99991988 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propoxy]benzaldehyde |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCOc1cccc(C=O)c1 |
| InChI | InChI=1S/C17H25NO2/c1-14-6-3-7-15(2)18(14)10-5-11-20-17-9-4-8-16(12-17)13-19/h4,8-9,12-15H,3,5-7,10-11H2,1-2H3/t14-,15+ |
| InChIKey | WYOIWKKKCRPOMC-GASCZTMLSA-N |
| XLogP | 3.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|