C18H27NO2 — CID 99992136
3-[4-[(2R,6R)-2,6-dimethylpiperidin-1-yl]butoxy]benzaldehyde (PubChem CID 99992136) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-[4-[(2R,6R)-2,6-dimethylpiperidin-1-yl]butoxy]benzaldehyde.
| Compound Name | 3-[4-[(2R,6R)-2,6-dimethylpiperidin-1-yl]butoxy]benzaldehyde |
|---|---|
| PubChem CID | 99992136 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 3-[4-[(2R,6R)-2,6-dimethylpiperidin-1-yl]butoxy]benzaldehyde |
| SMILES | C[C@@H]1CCC[C@@H](C)N1CCCCOc1cccc(C=O)c1 |
| InChI | InChI=1S/C18H27NO2/c1-15-7-5-8-16(2)19(15)11-3-4-12-21-18-10-6-9-17(13-18)14-20/h6,9-10,13-16H,3-5,7-8,11-12H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | DMMOKWRPHDEISO-HZPDHXFCSA-N |
| XLogP | 3.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|