About 3-butoxybenzaldehyde;ethane
3-butoxybenzaldehyde;ethane (PubChem CID 91380350) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is 3-butoxybenzaldehyde;ethane.
Molecular Properties
| Compound Name | 3-butoxybenzaldehyde;ethane |
| PubChem CID | 91380350 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 3-butoxybenzaldehyde;ethane |
| SMILES | CC.CC.CCCCOc1cccc(C=O)c1 |
| InChI | InChI=1S/C11H14O2.2C2H6/c1-2-3-7-13-11-6-4-5-10(8-11)9-12;2*1-2/h4-6,8-9H,2-3,7H2,1H3;2*1-2H3 |
| InChIKey | VWDLAHBCTPLPLO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxybenzaldehyde;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxybenzaldehyde;ethane?
The IUPAC name of 3-butoxybenzaldehyde;ethane (CID 91380350) is 3-butoxybenzaldehyde;ethane.
What is the SMILES notation for 3-butoxybenzaldehyde;ethane?
The canonical SMILES for 3-butoxybenzaldehyde;ethane is CC.CC.CCCCOc1cccc(C=O)c1.
What is the InChIKey of 3-butoxybenzaldehyde;ethane?
The InChIKey is VWDLAHBCTPLPLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2.2C2H6/c1-2-3-7-13-11-6-4-5-10(8-11)9-12;2*1-2/h4-6,8-9H,2-3,7H2,1H3;2*1-2H3.
What are the key properties of 3-butoxybenzaldehyde;ethane?
3-butoxybenzaldehyde;ethane has a molecular weight of 238.37 g/mol, XLogP of 4.73, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxybenzaldehyde;ethane is sourced from PubChem (CID 91380350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).