C25H30O3 — CID 77385934
1,5-bis(3-butoxyphenyl)penta-1,4-dien-3-one (PubChem CID 77385934) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is 1,5-bis(3-butoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | 1,5-bis(3-butoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 77385934 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1,5-bis(3-butoxyphenyl)penta-1,4-dien-3-one |
| SMILES | CCCCOc1cccc(C=CC(=O)C=Cc2cccc(OCCCC)c2)c1 |
| InChI | InChI=1S/C25H30O3/c1-3-5-17-27-24-11-7-9-21(19-24)13-15-23(26)16-14-22-10-8-12-25(20-22)28-18-6-4-2/h7-16,19-20H,3-6,17-18H2,1-2H3 |
| InChIKey | LCUNJALORQQILK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|