C19H18F2O2 — CID 89063547
(E)-3-(3-butoxyphenyl)-1-(2,5-difluorophenyl)prop-2-en-1-one (PubChem CID 89063547) has the molecular formula C19H18F2O2 and a molecular weight of 316.35 g/mol. Its IUPAC name is (E)-3-(3-butoxyphenyl)-1-(2,5-difluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-butoxyphenyl)-1-(2,5-difluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 89063547 |
| Molecular Formula | C19H18F2O2 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (E)-3-(3-butoxyphenyl)-1-(2,5-difluorophenyl)prop-2-en-1-one |
| SMILES | CCCCOc1cccc(/C=C/C(=O)c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C19H18F2O2/c1-2-3-11-23-16-6-4-5-14(12-16)7-10-19(22)17-13-15(20)8-9-18(17)21/h4-10,12-13H,2-3,11H2,1H3/b10-7+ |
| InChIKey | RZTMTPLRNHLZBD-JXMROGBWSA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|