C26H36O3 — CID 173400330
3,7-dimethyl-9-(3-nonoxyphenyl)nona-2,4,6,8-tetraenoic acid (PubChem CID 173400330) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is 3,7-dimethyl-9-(3-nonoxyphenyl)nona-2,4,6,8-tetraenoic acid.
| Compound Name | 3,7-dimethyl-9-(3-nonoxyphenyl)nona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 173400330 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | 3,7-dimethyl-9-(3-nonoxyphenyl)nona-2,4,6,8-tetraenoic acid |
| SMILES | CCCCCCCCCOc1cccc(C=CC(C)=CC=CC(C)=CC(=O)O)c1 |
| InChI | InChI=1S/C26H36O3/c1-4-5-6-7-8-9-10-19-29-25-16-12-15-24(21-25)18-17-22(2)13-11-14-23(3)20-26(27)28/h11-18,20-21H,4-10,19H2,1-3H3,(H,27,28) |
| InChIKey | OIPRYFAFIXJRDI-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|