C12H14N4O2S — CID 71641409
N-methyl-5-nitro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine (PubChem CID 71641409) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is N-methyl-5-nitro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine.
| Compound Name | N-methyl-5-nitro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 71641409 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | N-methyl-5-nitro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine |
| SMILES | CN(c1nc2cc([N+](=O)[O-])ccc2s1)C1CCNC1 |
| InChI | InChI=1S/C12H14N4O2S/c1-15(9-4-5-13-7-9)12-14-10-6-8(16(17)18)2-3-11(10)19-12/h2-3,6,9,13H,4-5,7H2,1H3 |
| InChIKey | IRQXSHXDQLKUBJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|