C17H22N4O4S — CID 71647120
tert-butyl 3-[methyl-(5-nitro-1,3-benzothiazol-2-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 71647120) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is tert-butyl 3-[methyl-(5-nitro-1,3-benzothiazol-2-yl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[methyl-(5-nitro-1,3-benzothiazol-2-yl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71647120 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | tert-butyl 3-[methyl-(5-nitro-1,3-benzothiazol-2-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | CN(c1nc2cc([N+](=O)[O-])ccc2s1)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H22N4O4S/c1-17(2,3)25-16(22)20-8-7-12(10-20)19(4)15-18-13-9-11(21(23)24)5-6-14(13)26-15/h5-6,9,12H,7-8,10H2,1-4H3 |
| InChIKey | IEYQUBDBDPWVHM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|