C18H23N3O4S2 — CID 71302760
tert-butyl 3-[(5-nitro-1,3-benzothiazol-2-yl)sulfanylmethyl]piperidine-1-carboxylate (PubChem CID 71302760) has the molecular formula C18H23N3O4S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is tert-butyl 3-[(5-nitro-1,3-benzothiazol-2-yl)sulfanylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(5-nitro-1,3-benzothiazol-2-yl)sulfanylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71302760 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | tert-butyl 3-[(5-nitro-1,3-benzothiazol-2-yl)sulfanylmethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CSc2nc3cc([N+](=O)[O-])ccc3s2)C1 |
| InChI | InChI=1S/C18H23N3O4S2/c1-18(2,3)25-17(22)20-8-4-5-12(10-20)11-26-16-19-14-9-13(21(23)24)6-7-15(14)27-16/h6-7,9,12H,4-5,8,10-11H2,1-3H3 |
| InChIKey | JMCUVPSAKCCGSF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|