C19H25N5O4 — CID 97172273
tert-butyl (3S)-3-[[(6-nitroquinoxalin-2-yl)amino]methyl]piperidine-1-carboxylate (PubChem CID 97172273) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[(6-nitroquinoxalin-2-yl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[(6-nitroquinoxalin-2-yl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97172273 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | tert-butyl (3S)-3-[[(6-nitroquinoxalin-2-yl)amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](CNc2cnc3cc([N+](=O)[O-])ccc3n2)C1 |
| InChI | InChI=1S/C19H25N5O4/c1-19(2,3)28-18(25)23-8-4-5-13(12-23)10-21-17-11-20-16-9-14(24(26)27)6-7-15(16)22-17/h6-7,9,11,13H,4-5,8,10,12H2,1-3H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | BQNPYRWZGQTZBJ-ZDUSSCGKSA-N |
| XLogP | 3.60 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|