C19H26N4O4S — CID 97167180
tert-butyl (2R)-2-[[methyl-(5-nitro-1,3-benzothiazol-2-yl)amino]methyl]piperidine-1-carboxylate (PubChem CID 97167180) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[methyl-(5-nitro-1,3-benzothiazol-2-yl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[methyl-(5-nitro-1,3-benzothiazol-2-yl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97167180 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | tert-butyl (2R)-2-[[methyl-(5-nitro-1,3-benzothiazol-2-yl)amino]methyl]piperidine-1-carboxylate |
| SMILES | CN(C[C@H]1CCCCN1C(=O)OC(C)(C)C)c1nc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C19H26N4O4S/c1-19(2,3)27-18(24)22-10-6-5-7-14(22)12-21(4)17-20-15-11-13(23(25)26)8-9-16(15)28-17/h8-9,11,14H,5-7,10,12H2,1-4H3/t14-/m1/s1 |
| InChIKey | FTNLKBUAUYUIOT-CQSZACIVSA-N |
| XLogP | 4.43 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|