C18H24N4O4S — CID 97031700
tert-butyl (2R)-2-[(6-nitro-1H-benzimidazol-2-yl)sulfanylmethyl]piperidine-1-carboxylate (PubChem CID 97031700) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(6-nitro-1H-benzimidazol-2-yl)sulfanylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(6-nitro-1H-benzimidazol-2-yl)sulfanylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97031700 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | tert-butyl (2R)-2-[(6-nitro-1H-benzimidazol-2-yl)sulfanylmethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@@H]1CSc1nc2ccc([N+](=O)[O-])cc2[nH]1 |
| InChI | InChI=1S/C18H24N4O4S/c1-18(2,3)26-17(23)21-9-5-4-6-13(21)11-27-16-19-14-8-7-12(22(24)25)10-15(14)20-16/h7-8,10,13H,4-6,9,11H2,1-3H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | COQBFUDSSYOQCN-CYBMUJFWSA-N |
| XLogP | 4.35 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|