C17H21N3O7S — CID 71630421
tert-butyl 3-[(5-nitro-1,3-benzoxazol-2-yl)sulfonylmethyl]pyrrolidine-1-carboxylate (PubChem CID 71630421) has the molecular formula C17H21N3O7S and a molecular weight of 411.44 g/mol. Its IUPAC name is tert-butyl 3-[(5-nitro-1,3-benzoxazol-2-yl)sulfonylmethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(5-nitro-1,3-benzoxazol-2-yl)sulfonylmethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71630421 |
| Molecular Formula | C17H21N3O7S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | tert-butyl 3-[(5-nitro-1,3-benzoxazol-2-yl)sulfonylmethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CS(=O)(=O)c2nc3cc([N+](=O)[O-])ccc3o2)C1 |
| InChI | InChI=1S/C17H21N3O7S/c1-17(2,3)27-16(21)19-7-6-11(9-19)10-28(24,25)15-18-13-8-12(20(22)23)4-5-14(13)26-15/h4-5,8,11H,6-7,9-10H2,1-3H3 |
| InChIKey | PVPJMCUVAOXYPF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 132.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|