About tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate
tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate (PubChem CID 97171116) has the molecular formula C17H21N3O6S
and a molecular weight of 395.44 g/mol. Its IUPAC name is tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate |
| PubChem CID | 97171116 |
| Molecular Formula | C17H21N3O6S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC([S@](=O)c2nc3cc([N+](=O)[O-])ccc3o2)CC1 |
| InChI | InChI=1S/C17H21N3O6S/c1-17(2,3)26-16(21)19-8-6-12(7-9-19)27(24)15-18-13-10-11(20(22)23)4-5-14(13)25-15/h4-5,10,12H,6-9H2,1-3H3/t27-/m0/s1 |
| InChIKey | OCVQXTMIBKHHPX-MHZLTWQESA-N |
| XLogP | 3.24 |
| TPSA | 115.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate (CID 97171116) is tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC([S@](=O)c2nc3cc([N+](=O)[O-])ccc3o2)CC1.
What is the InChIKey of tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate?
The InChIKey is OCVQXTMIBKHHPX-MHZLTWQESA-N. The full InChI is InChI=1S/C17H21N3O6S/c1-17(2,3)26-16(21)19-8-6-12(7-9-19)27(24)15-18-13-10-11(20(22)23)4-5-14(13)25-15/h4-5,10,12H,6-9H2,1-3H3/t27-/m0/s1.
What are the key properties of tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate?
tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate has a molecular weight of 395.44 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(S)-(5-nitro-1,3-benzoxazol-2-yl)sulfinyl]piperidine-1-carboxylate is sourced from PubChem (CID 97171116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).