C18H24N4O5 — CID 97167617
tert-butyl (3S)-3-[[methyl-(5-nitro-1,3-benzoxazol-2-yl)amino]methyl]pyrrolidine-1-carboxylate (PubChem CID 97167617) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[methyl-(5-nitro-1,3-benzoxazol-2-yl)amino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[methyl-(5-nitro-1,3-benzoxazol-2-yl)amino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97167617 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | tert-butyl (3S)-3-[[methyl-(5-nitro-1,3-benzoxazol-2-yl)amino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CN(C[C@@H]1CCN(C(=O)OC(C)(C)C)C1)c1nc2cc([N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C18H24N4O5/c1-18(2,3)27-17(23)21-8-7-12(11-21)10-20(4)16-19-14-9-13(22(24)25)5-6-15(14)26-16/h5-6,9,12H,7-8,10-11H2,1-4H3/t12-/m0/s1 |
| InChIKey | RMXHONAMYOVEDY-LBPRGKRZSA-N |
| XLogP | 3.43 |
| TPSA | 101.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|