C17H22N2O4S — CID 71630000
tert-butyl 4-(1,3-benzoxazol-2-ylsulfinyl)piperidine-1-carboxylate (PubChem CID 71630000) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is tert-butyl 4-(1,3-benzoxazol-2-ylsulfinyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(1,3-benzoxazol-2-ylsulfinyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71630000 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | tert-butyl 4-(1,3-benzoxazol-2-ylsulfinyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(S(=O)c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C17H22N2O4S/c1-17(2,3)23-16(20)19-10-8-12(9-11-19)24(21)15-18-13-6-4-5-7-14(13)22-15/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | HHJJYODYPDRFQZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |