C15H22N4O4 — CID 71646778
tert-butyl (3S)-3-[methyl-(3-nitro-2-pyridinyl)amino]pyrrolidine-1-carboxylate (PubChem CID 71646778) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is tert-butyl (3S)-3-[methyl-(3-nitro-2-pyridinyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[methyl-(3-nitro-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71646778 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | tert-butyl (3S)-3-[methyl-(3-nitro-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CN(c1ncccc1[N+](=O)[O-])[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H22N4O4/c1-15(2,3)23-14(20)18-9-7-11(10-18)17(4)13-12(19(21)22)6-5-8-16-13/h5-6,8,11H,7,9-10H2,1-4H3/t11-/m0/s1 |
| InChIKey | WJZDBICSUSUAID-NSHDSACASA-N |
| XLogP | 2.44 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|