C17H24N4O2 — CID 59362085
tert-butyl 4-[(3-cyano-2-pyridinyl)-methylamino]piperidine-1-carboxylate (PubChem CID 59362085) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is tert-butyl 4-[(3-cyano-2-pyridinyl)-methylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-cyano-2-pyridinyl)-methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59362085 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | tert-butyl 4-[(3-cyano-2-pyridinyl)-methylamino]piperidine-1-carboxylate |
| SMILES | CN(c1ncccc1C#N)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H24N4O2/c1-17(2,3)23-16(22)21-10-7-14(8-11-21)20(4)15-13(12-18)6-5-9-19-15/h5-6,9,14H,7-8,10-11H2,1-4H3 |
| InChIKey | TVSOEQYJWVMEOL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |