C17H26N4O4 — CID 97167307
tert-butyl (3S)-3-[[methyl-(3-nitro-2-pyridinyl)amino]methyl]piperidine-1-carboxylate (PubChem CID 97167307) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[methyl-(3-nitro-2-pyridinyl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[methyl-(3-nitro-2-pyridinyl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97167307 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | tert-butyl (3S)-3-[[methyl-(3-nitro-2-pyridinyl)amino]methyl]piperidine-1-carboxylate |
| SMILES | CN(C[C@@H]1CCCN(C(=O)OC(C)(C)C)C1)c1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N4O4/c1-17(2,3)25-16(22)20-10-6-7-13(12-20)11-19(4)15-14(21(23)24)8-5-9-18-15/h5,8-9,13H,6-7,10-12H2,1-4H3/t13-/m0/s1 |
| InChIKey | JMRAKXINAHSMNE-ZDUSSCGKSA-N |
| XLogP | 3.07 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|