C13H16ClN5O2 — CID 71641222
N-methyl-6-nitro-N-[(3S)-pyrrolidin-3-yl]quinoxalin-2-amine;hydrochloride (PubChem CID 71641222) has the molecular formula C13H16ClN5O2 and a molecular weight of 309.76 g/mol. Its IUPAC name is N-methyl-6-nitro-N-[(3S)-pyrrolidin-3-yl]quinoxalin-2-amine;hydrochloride.
| Compound Name | N-methyl-6-nitro-N-[(3S)-pyrrolidin-3-yl]quinoxalin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71641222 |
| Molecular Formula | C13H16ClN5O2 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-methyl-6-nitro-N-[(3S)-pyrrolidin-3-yl]quinoxalin-2-amine;hydrochloride |
| SMILES | CN(c1cnc2cc([N+](=O)[O-])ccc2n1)[C@H]1CCNC1.Cl |
| InChI | InChI=1S/C13H15N5O2.ClH/c1-17(10-4-5-14-7-10)13-8-15-12-6-9(18(19)20)2-3-11(12)16-13;/h2-3,6,8,10,14H,4-5,7H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | OTYBULGFIVWJTK-PPHPATTJSA-N |
| XLogP | 1.76 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|