C13H14N4O4S — CID 97178113
6-nitro-2-[[(3S)-pyrrolidin-3-yl]methylsulfonyl]quinoxaline (PubChem CID 97178113) has the molecular formula C13H14N4O4S and a molecular weight of 322.35 g/mol. Its IUPAC name is 6-nitro-2-[[(3S)-pyrrolidin-3-yl]methylsulfonyl]quinoxaline.
| Compound Name | 6-nitro-2-[[(3S)-pyrrolidin-3-yl]methylsulfonyl]quinoxaline |
|---|---|
| PubChem CID | 97178113 |
| Molecular Formula | C13H14N4O4S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 6-nitro-2-[[(3S)-pyrrolidin-3-yl]methylsulfonyl]quinoxaline |
| SMILES | O=[N+]([O-])c1ccc2nc(S(=O)(=O)C[C@H]3CCNC3)cnc2c1 |
| InChI | InChI=1S/C13H14N4O4S/c18-17(19)10-1-2-11-12(5-10)15-7-13(16-11)22(20,21)8-9-3-4-14-6-9/h1-2,5,7,9,14H,3-4,6,8H2/t9-/m0/s1 |
| InChIKey | GQEGXMVVMZDZBU-VIFPVBQESA-N |
| XLogP | 0.92 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|