C14H16N4O3S — CID 97178132
6-nitro-2-[(S)-[(3R)-piperidin-3-yl]methylsulfinyl]quinoxaline (PubChem CID 97178132) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is 6-nitro-2-[(S)-[(3R)-piperidin-3-yl]methylsulfinyl]quinoxaline.
| Compound Name | 6-nitro-2-[(S)-[(3R)-piperidin-3-yl]methylsulfinyl]quinoxaline |
|---|---|
| PubChem CID | 97178132 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 6-nitro-2-[(S)-[(3R)-piperidin-3-yl]methylsulfinyl]quinoxaline |
| SMILES | O=[N+]([O-])c1ccc2nc([S@@](=O)C[C@@H]3CCCNC3)cnc2c1 |
| InChI | InChI=1S/C14H16N4O3S/c19-18(20)11-3-4-12-13(6-11)16-8-14(17-12)22(21)9-10-2-1-5-15-7-10/h3-4,6,8,10,15H,1-2,5,7,9H2/t10-,22+/m1/s1 |
| InChIKey | IPMNWFIJXVOGRH-STFLBKPXSA-N |
| XLogP | 1.65 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|