C13H17ClN4O3S — CID 71636053
6-nitro-2-(piperidin-3-ylmethylsulfinyl)-1H-benzimidazole;hydrochloride (PubChem CID 71636053) has the molecular formula C13H17ClN4O3S and a molecular weight of 344.82 g/mol. Its IUPAC name is 6-nitro-2-(piperidin-3-ylmethylsulfinyl)-1H-benzimidazole;hydrochloride.
| Compound Name | 6-nitro-2-(piperidin-3-ylmethylsulfinyl)-1H-benzimidazole;hydrochloride |
|---|---|
| PubChem CID | 71636053 |
| Molecular Formula | C13H17ClN4O3S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 6-nitro-2-(piperidin-3-ylmethylsulfinyl)-1H-benzimidazole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2nc(S(=O)CC3CCCNC3)[nH]c2c1 |
| InChI | InChI=1S/C13H16N4O3S.ClH/c18-17(19)10-3-4-11-12(6-10)16-13(15-11)21(20)8-9-2-1-5-14-7-9;/h3-4,6,9,14H,1-2,5,7-8H2,(H,15,16);1H |
| InChIKey | XRTJKYRQXYNVPS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|